C10H8Cl2F2N4 — CID 176909398
2,6-dichloro-9-[(3,3-difluorocyclobutyl)methyl]purine (PubChem CID 176909398) has the molecular formula C10H8Cl2F2N4 and a molecular weight of 293.10 g/mol. Its IUPAC name is 2,6-dichloro-9-[(3,3-difluorocyclobutyl)methyl]purine.
| Compound Name | 2,6-dichloro-9-[(3,3-difluorocyclobutyl)methyl]purine |
|---|---|
| PubChem CID | 176909398 |
| Molecular Formula | C10H8Cl2F2N4 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2,6-dichloro-9-[(3,3-difluorocyclobutyl)methyl]purine |
| SMILES | FC1(F)CC(Cn2cnc3c(Cl)nc(Cl)nc32)C1 |
| InChI | InChI=1S/C10H8Cl2F2N4/c11-7-6-8(17-9(12)16-7)18(4-15-6)3-5-1-10(13,14)2-5/h4-5H,1-3H2 |
| InChIKey | UGOIBZRPNQEOES-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |