C20H29NO — CID 176909640
9,9-dimethyl-7-(4-pentylphenyl)-1-oxa-6-azaspiro[4.4]non-6-ene (PubChem CID 176909640) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 9,9-dimethyl-7-(4-pentylphenyl)-1-oxa-6-azaspiro[4.4]non-6-ene.
| Compound Name | 9,9-dimethyl-7-(4-pentylphenyl)-1-oxa-6-azaspiro[4.4]non-6-ene |
|---|---|
| PubChem CID | 176909640 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 9,9-dimethyl-7-(4-pentylphenyl)-1-oxa-6-azaspiro[4.4]non-6-ene |
| SMILES | CCCCCc1ccc(C2=NC3(CCCO3)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C20H29NO/c1-4-5-6-8-16-9-11-17(12-10-16)18-15-19(2,3)20(21-18)13-7-14-22-20/h9-12H,4-8,13-15H2,1-3H3 |
| InChIKey | XPWSRHHYNHTRKJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|