C22H23N3O3 — CID 176909761
(2E)-6-(4-methylpiperazin-1-yl)-2-[(3-nitrophenyl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 176909761) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2E)-6-(4-methylpiperazin-1-yl)-2-[(3-nitrophenyl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-6-(4-methylpiperazin-1-yl)-2-[(3-nitrophenyl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 176909761 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2E)-6-(4-methylpiperazin-1-yl)-2-[(3-nitrophenyl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | CN1CCN(c2ccc3c(c2)CC/C(=C\c2cccc([N+](=O)[O-])c2)C3=O)CC1 |
| InChI | InChI=1S/C22H23N3O3/c1-23-9-11-24(12-10-23)19-7-8-21-17(15-19)5-6-18(22(21)26)13-16-3-2-4-20(14-16)25(27)28/h2-4,7-8,13-15H,5-6,9-12H2,1H3/b18-13+ |
| InChIKey | XVGUYOKPPJYDAR-QGOAFFKASA-N |
| XLogP | 3.56 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|