C19H26N4 — CID 176910052
(1S)-2-ethyl-1-methyl-8-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole (PubChem CID 176910052) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is (1S)-2-ethyl-1-methyl-8-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole.
| Compound Name | (1S)-2-ethyl-1-methyl-8-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 176910052 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (1S)-2-ethyl-1-methyl-8-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole |
| SMILES | CCN1CCn2c(nc3cc(C4=NC[C@@H](C)CC4)ccc32)[C@@H]1C |
| InChI | InChI=1S/C19H26N4/c1-4-22-9-10-23-18-8-6-15(16-7-5-13(2)12-20-16)11-17(18)21-19(23)14(22)3/h6,8,11,13-14H,4-5,7,9-10,12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | YNKLMFVBUJLWNE-KBPBESRZSA-N |
| XLogP | 3.65 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |