C12H17ClO4 — CID 176910307
3-(2-chloro-5-methylphenoxy)-2,2-dimethoxypropan-1-ol (PubChem CID 176910307) has the molecular formula C12H17ClO4 and a molecular weight of 260.72 g/mol. Its IUPAC name is 3-(2-chloro-5-methylphenoxy)-2,2-dimethoxypropan-1-ol.
| Compound Name | 3-(2-chloro-5-methylphenoxy)-2,2-dimethoxypropan-1-ol |
|---|---|
| PubChem CID | 176910307 |
| Molecular Formula | C12H17ClO4 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-(2-chloro-5-methylphenoxy)-2,2-dimethoxypropan-1-ol |
| SMILES | COC(CO)(COc1cc(C)ccc1Cl)OC |
| InChI | InChI=1S/C12H17ClO4/c1-9-4-5-10(13)11(6-9)17-8-12(7-14,15-2)16-3/h4-6,14H,7-8H2,1-3H3 |
| InChIKey | QGAJNWTYVIBGRG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|