C9H14N2O — CID 176910983
2-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-enal (PubChem CID 176910983) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-enal.
| Compound Name | 2-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-enal |
|---|---|
| PubChem CID | 176910983 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-enal |
| SMILES | C=C(C=O)N1CCC2(CNC2)C1 |
| InChI | InChI=1S/C9H14N2O/c1-8(4-12)11-3-2-9(7-11)5-10-6-9/h4,10H,1-3,5-7H2 |
| InChIKey | XCRQMLKTTWNHOM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|