C21H18F6N4O4 — CID 176911219
N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 176911219) has the molecular formula C21H18F6N4O4 and a molecular weight of 504.39 g/mol. Its IUPAC name is N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176911219 |
| Molecular Formula | C21H18F6N4O4 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC(F)(F)[C@@H]1O)c1cn2cc(Oc3ncc(F)cc3OCC(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C21H18F6N4O4/c22-11-6-15(34-10-21(25,26)27)19(28-7-11)35-12-3-4-16-29-14(9-31(16)8-12)18(33)30-13-2-1-5-20(23,24)17(13)32/h3-4,6-9,13,17,32H,1-2,5,10H2,(H,30,33)/t13-,17+/m0/s1 |
| InChIKey | OSEAOUHKSBJWGF-SUMWQHHRSA-N |
| XLogP | 3.88 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |