About methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate
methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate (PubChem CID 176911236) has the molecular formula C27H21F2N3O3
and a molecular weight of 473.48 g/mol. Its IUPAC name is methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate |
| PubChem CID | 176911236 |
| Molecular Formula | C27H21F2N3O3 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CCC(=O)CC4)c3c2)n1 |
| InChI | InChI=1S/C27H21F2N3O3/c1-35-27(34)25-4-2-3-23(31-25)16-5-6-24-21(13-16)26(32-9-7-20(33)8-10-32)22(15-30-24)17-11-18(28)14-19(29)12-17/h2-6,11-15H,7-10H2,1H3 |
| InChIKey | PNBYGQXZCGXCBE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate (CID 176911236) is methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate is COC(=O)c1cccc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CCC(=O)CC4)c3c2)n1.
What is the InChIKey of methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate?
The InChIKey is PNBYGQXZCGXCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21F2N3O3/c1-35-27(34)25-4-2-3-23(31-25)16-5-6-24-21(13-16)26(32-9-7-20(33)8-10-32)22(15-30-24)17-11-18(28)14-19(29)12-17/h2-6,11-15H,7-10H2,1H3.
What are the key properties of methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate?
methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate has a molecular weight of 473.48 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[3-(3,5-difluorophenyl)-4-(4-oxopiperidin-1-yl)quinolin-6-yl]pyridine-2-carboxylate is sourced from PubChem (CID 176911236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).