C28H22N6O2 — CID 176911474
4-[[[7-(4-ethenylphenyl)-2-(pyrimidin-2-ylamino)quinazolin-4-yl]amino]methyl]benzoic acid (PubChem CID 176911474) has the molecular formula C28H22N6O2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 4-[[[7-(4-ethenylphenyl)-2-(pyrimidin-2-ylamino)quinazolin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[7-(4-ethenylphenyl)-2-(pyrimidin-2-ylamino)quinazolin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176911474 |
| Molecular Formula | C28H22N6O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-[[[7-(4-ethenylphenyl)-2-(pyrimidin-2-ylamino)quinazolin-4-yl]amino]methyl]benzoic acid |
| SMILES | C=Cc1ccc(-c2ccc3c(NCc4ccc(C(=O)O)cc4)nc(Nc4ncccn4)nc3c2)cc1 |
| InChI | InChI=1S/C28H22N6O2/c1-2-18-4-8-20(9-5-18)22-12-13-23-24(16-22)32-28(34-27-29-14-3-15-30-27)33-25(23)31-17-19-6-10-21(11-7-19)26(35)36/h2-16H,1,17H2,(H,35,36)(H2,29,30,31,32,33,34) |
| InChIKey | QMEFGGLFUGYINX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |