C27H21N5O2 — CID 176911481
4-[[[7-(4-ethenylphenyl)-2-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]methyl]benzoic acid (PubChem CID 176911481) has the molecular formula C27H21N5O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-[[[7-(4-ethenylphenyl)-2-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[7-(4-ethenylphenyl)-2-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176911481 |
| Molecular Formula | C27H21N5O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-[[[7-(4-ethenylphenyl)-2-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]methyl]benzoic acid |
| SMILES | C=Cc1ccc(-c2ccc3c(NCc4ccc(C(=O)O)cc4)nc(-c4ccn[nH]4)nc3c2)cc1 |
| InChI | InChI=1S/C27H21N5O2/c1-2-17-3-7-19(8-4-17)21-11-12-22-24(15-21)30-26(23-13-14-29-32-23)31-25(22)28-16-18-5-9-20(10-6-18)27(33)34/h2-15H,1,16H2,(H,29,32)(H,33,34)(H,28,30,31) |
| InChIKey | RYZPBMHTZGQTOB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |