C30H22ClN3O2 — CID 176911482
4-[[[2-(4-chlorophenyl)-7-(4-ethenylphenyl)quinazolin-4-yl]amino]methyl]benzoic acid (PubChem CID 176911482) has the molecular formula C30H22ClN3O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is 4-[[[2-(4-chlorophenyl)-7-(4-ethenylphenyl)quinazolin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(4-chlorophenyl)-7-(4-ethenylphenyl)quinazolin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176911482 |
| Molecular Formula | C30H22ClN3O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-[[[2-(4-chlorophenyl)-7-(4-ethenylphenyl)quinazolin-4-yl]amino]methyl]benzoic acid |
| SMILES | C=Cc1ccc(-c2ccc3c(NCc4ccc(C(=O)O)cc4)nc(-c4ccc(Cl)cc4)nc3c2)cc1 |
| InChI | InChI=1S/C30H22ClN3O2/c1-2-19-3-7-21(8-4-19)24-13-16-26-27(17-24)33-28(22-11-14-25(31)15-12-22)34-29(26)32-18-20-5-9-23(10-6-20)30(35)36/h2-17H,1,18H2,(H,35,36)(H,32,33,34) |
| InChIKey | NPCRCTORMULQGN-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |