C29H22N4O2 — CID 176911492
4-[[[7-(4-ethenylphenyl)-2-pyridin-4-ylquinazolin-4-yl]amino]methyl]benzoic acid (PubChem CID 176911492) has the molecular formula C29H22N4O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-[[[7-(4-ethenylphenyl)-2-pyridin-4-ylquinazolin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[7-(4-ethenylphenyl)-2-pyridin-4-ylquinazolin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176911492 |
| Molecular Formula | C29H22N4O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-[[[7-(4-ethenylphenyl)-2-pyridin-4-ylquinazolin-4-yl]amino]methyl]benzoic acid |
| SMILES | C=Cc1ccc(-c2ccc3c(NCc4ccc(C(=O)O)cc4)nc(-c4ccncc4)nc3c2)cc1 |
| InChI | InChI=1S/C29H22N4O2/c1-2-19-3-7-21(8-4-19)24-11-12-25-26(17-24)32-27(22-13-15-30-16-14-22)33-28(25)31-18-20-5-9-23(10-6-20)29(34)35/h2-17H,1,18H2,(H,34,35)(H,31,32,33) |
| InChIKey | KLMBPAZZQWKINH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |