C21H34BNO2Se — CID 176911851
3-[4-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]selanylpyridine (PubChem CID 176911851) has the molecular formula C21H34BNO2Se and a molecular weight of 422.28 g/mol. Its IUPAC name is 3-[4-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]selanylpyridine.
| Compound Name | 3-[4-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]selanylpyridine |
|---|---|
| PubChem CID | 176911851 |
| Molecular Formula | C21H34BNO2Se |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[4-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]selanylpyridine |
| SMILES | CC1(C)OB(C(CCC[Se]c2cccnc2)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C21H34BNO2Se/c1-20(2)21(3,4)25-22(24-20)19(17-10-6-5-7-11-17)13-9-15-26-18-12-8-14-23-16-18/h8,12,14,16-17,19H,5-7,9-11,13,15H2,1-4H3 |
| InChIKey | YYWDSULLMTYVOD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|