C20H36BNO2 — CID 176911868
8-cyclohexyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanenitrile (PubChem CID 176911868) has the molecular formula C20H36BNO2 and a molecular weight of 333.33 g/mol. Its IUPAC name is 8-cyclohexyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanenitrile.
| Compound Name | 8-cyclohexyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanenitrile |
|---|---|
| PubChem CID | 176911868 |
| Molecular Formula | C20H36BNO2 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 8-cyclohexyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanenitrile |
| SMILES | CC1(C)OB(C(CCCCCCC#N)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C20H36BNO2/c1-19(2)20(3,4)24-21(23-19)18(17-13-9-8-10-14-17)15-11-6-5-7-12-16-22/h17-18H,5-15H2,1-4H3 |
| InChIKey | VQMUPQXPMQGFOT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|