C17H30BNO2 — CID 176911875
5-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanenitrile (PubChem CID 176911875) has the molecular formula C17H30BNO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is 5-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanenitrile.
| Compound Name | 5-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 176911875 |
| Molecular Formula | C17H30BNO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 5-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanenitrile |
| SMILES | CC1(C)OB(C(CCCC#N)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C17H30BNO2/c1-16(2)17(3,4)21-18(20-16)15(12-8-9-13-19)14-10-6-5-7-11-14/h14-15H,5-12H2,1-4H3 |
| InChIKey | BBTCQSDRAMXNEE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|