C18H32BNO2 — CID 176911880
6-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanenitrile (PubChem CID 176911880) has the molecular formula C18H32BNO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is 6-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanenitrile.
| Compound Name | 6-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanenitrile |
|---|---|
| PubChem CID | 176911880 |
| Molecular Formula | C18H32BNO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 6-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanenitrile |
| SMILES | CC1(C)OB(C(CCCCC#N)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C18H32BNO2/c1-17(2)18(3,4)22-19(21-17)16(13-9-6-10-14-20)15-11-7-5-8-12-15/h15-16H,5-13H2,1-4H3 |
| InChIKey | GDUXPUGSJYJGDP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|