C24H32FN5O3 — CID 176911901
4-[4-(7-azaspiro[3.5]nonan-2-yl)piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-3-fluorobenzamide (PubChem CID 176911901) has the molecular formula C24H32FN5O3 and a molecular weight of 457.55 g/mol. Its IUPAC name is 4-[4-(7-azaspiro[3.5]nonan-2-yl)piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-3-fluorobenzamide.
| Compound Name | 4-[4-(7-azaspiro[3.5]nonan-2-yl)piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 176911901 |
| Molecular Formula | C24H32FN5O3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-[4-(7-azaspiro[3.5]nonan-2-yl)piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-3-fluorobenzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc(N3CCN(C4CC5(CCNCC5)C4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C24H32FN5O3/c25-18-13-16(22(32)27-19-2-4-21(31)28-23(19)33)1-3-20(18)30-11-9-29(10-12-30)17-14-24(15-17)5-7-26-8-6-24/h1,3,13,17,19,26H,2,4-12,14-15H2,(H,27,32)(H,28,31,33) |
| InChIKey | RZOUVHBGJNUGAW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|