C16H21BF3NO2 — CID 176912780
1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)-3,4-dihydro-2H-isoquinoline (PubChem CID 176912780) has the molecular formula C16H21BF3NO2 and a molecular weight of 327.16 g/mol. Its IUPAC name is 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)-3,4-dihydro-2H-isoquinoline.
| Compound Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)-3,4-dihydro-2H-isoquinoline |
|---|---|
| PubChem CID | 176912780 |
| Molecular Formula | C16H21BF3NO2 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)-3,4-dihydro-2H-isoquinoline |
| SMILES | CC1(C)OB(C2(C(F)(F)F)NCCc3ccccc32)OC1(C)C |
| InChI | InChI=1S/C16H21BF3NO2/c1-13(2)14(3,4)23-17(22-13)15(16(18,19)20)12-8-6-5-7-11(12)9-10-21-15/h5-8,21H,9-10H2,1-4H3 |
| InChIKey | IAXBXRJGFIIVOC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|