C18H16F3N5O5S — CID 176912871
6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-N-(3-methyl-1,1-dioxothietan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 176912871) has the molecular formula C18H16F3N5O5S and a molecular weight of 471.42 g/mol. Its IUPAC name is 6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-N-(3-methyl-1,1-dioxothietan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-N-(3-methyl-1,1-dioxothietan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176912871 |
| Molecular Formula | C18H16F3N5O5S |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-N-(3-methyl-1,1-dioxothietan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | CC1(NC(=O)c2nc3ccc(Oc4ncc(F)cc4OCC(F)F)cn3n2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C18H16F3N5O5S/c1-18(8-32(28,29)9-18)24-16(27)15-23-14-3-2-11(6-26(14)25-15)31-17-12(30-7-13(20)21)4-10(19)5-22-17/h2-6,13H,7-9H2,1H3,(H,24,27) |
| InChIKey | CNMRCEYMHZRZBK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |