C20H19ClF3N5O5S — CID 176912876
6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 176912876) has the molecular formula C20H19ClF3N5O5S and a molecular weight of 533.92 g/mol. Its IUPAC name is 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176912876 |
| Molecular Formula | C20H19ClF3N5O5S |
| Molecular Weight | 533.92 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | CC1(NC(=O)c2nc3ccc(Oc4ncc(Cl)cc4OCC(F)(F)F)cn3n2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C20H19ClF3N5O5S/c1-19(4-6-35(31,32)7-5-19)27-17(30)16-26-15-3-2-13(10-29(15)28-16)34-18-14(8-12(21)9-25-18)33-11-20(22,23)24/h2-3,8-10H,4-7,11H2,1H3,(H,27,30) |
| InChIKey | WGMACKISWWHUQV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |