About 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide
3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide (PubChem CID 176912979) has the molecular formula C8H11F2N3O
and a molecular weight of 203.19 g/mol. Its IUPAC name is 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide |
| PubChem CID | 176912979 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]nc(C(F)F)c1C(=O)N(C)C |
| InChI | InChI=1S/C8H11F2N3O/c1-4-5(8(14)13(2)3)6(7(9)10)12-11-4/h7H,1-3H3,(H,11,12) |
| InChIKey | HCAMRYVPZKBFSM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide?
The IUPAC name of 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide (CID 176912979) is 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide?
The canonical SMILES for 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide is Cc1[nH]nc(C(F)F)c1C(=O)N(C)C.
What is the InChIKey of 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide?
The InChIKey is HCAMRYVPZKBFSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O/c1-4-5(8(14)13(2)3)6(7(9)10)12-11-4/h7H,1-3H3,(H,11,12).
What are the key properties of 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide?
3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide has a molecular weight of 203.19 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-N,N,5-trimethyl-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 176912979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).