About 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole
4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole (PubChem CID 176913798) has the molecular formula C4H6BrNS2
and a molecular weight of 212.14 g/mol. Its IUPAC name is 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole |
| PubChem CID | 176913798 |
| Molecular Formula | C4H6BrNS2 |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 210.91 |
| IUPAC Name | 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole |
| SMILES | CSC1=NC(Br)CS1 |
| InChI | InChI=1S/C4H6BrNS2/c1-7-4-6-3(5)2-8-4/h3H,2H2,1H3 |
| InChIKey | YNVVHQOWONKJJO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole?
The IUPAC name of 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole (CID 176913798) is 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole is CSC1=NC(Br)CS1.
What is the InChIKey of 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole?
The InChIKey is YNVVHQOWONKJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BrNS2/c1-7-4-6-3(5)2-8-4/h3H,2H2,1H3.
What are the key properties of 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole?
4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole has a molecular weight of 212.14 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methylsulfanyl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 176913798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).