C36H35FN10O — CID 176913816
1-cyano-2-[[4-[4-[2-fluoro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]pyrido[3,2-d]pyrimidin-7-yl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 176913816) has the molecular formula C36H35FN10O and a molecular weight of 642.74 g/mol. Its IUPAC name is 1-cyano-2-[[4-[4-[2-fluoro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]pyrido[3,2-d]pyrimidin-7-yl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[4-[4-[2-fluoro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]pyrido[3,2-d]pyrimidin-7-yl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 176913816 |
| Molecular Formula | C36H35FN10O |
| Molecular Weight | 642.74 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 1-cyano-2-[[4-[4-[2-fluoro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]pyrido[3,2-d]pyrimidin-7-yl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\Cc1cnc2c(N3CCc4c(-c5cccc(OCCCN6CCCC6)c5F)cccc43)ncnc2c1)Nc1ccncc1 |
| InChI | InChI=1S/C36H35FN10O/c37-33-29(7-4-9-32(33)48-19-5-17-46-15-1-2-16-46)27-6-3-8-31-28(27)12-18-47(31)35-34-30(43-24-44-35)20-25(21-40-34)22-41-36(42-23-38)45-26-10-13-39-14-11-26/h3-4,6-11,13-14,20-21,24H,1-2,5,12,15-19,22H2,(H2,39,41,42,45) |
| InChIKey | BZJDOBMRJDKBBB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|