C37H36ClN9O — CID 176913848
2-[[8-[4-[2-chloro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]-1,7-naphthyridin-3-yl]methyl]-1-cyano-3-pyridin-4-ylguanidine (PubChem CID 176913848) has the molecular formula C37H36ClN9O and a molecular weight of 658.21 g/mol. Its IUPAC name is 2-[[8-[4-[2-chloro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]-1,7-naphthyridin-3-yl]methyl]-1-cyano-3-pyridin-4-ylguanidine.
| Compound Name | 2-[[8-[4-[2-chloro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]-1,7-naphthyridin-3-yl]methyl]-1-cyano-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 176913848 |
| Molecular Formula | C37H36ClN9O |
| Molecular Weight | 658.21 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | 2-[[8-[4-[2-chloro-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydroindol-1-yl]-1,7-naphthyridin-3-yl]methyl]-1-cyano-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\Cc1cnc2c(N3CCc4c(-c5cccc(OCCCN6CCCC6)c5Cl)cccc43)nccc2c1)Nc1ccncc1 |
| InChI | InChI=1S/C37H36ClN9O/c38-34-31(7-4-9-33(34)48-21-5-19-46-17-1-2-18-46)29-6-3-8-32-30(29)13-20-47(32)36-35-27(10-16-41-36)22-26(23-42-35)24-43-37(44-25-39)45-28-11-14-40-15-12-28/h3-4,6-12,14-16,22-23H,1-2,5,13,17-21,24H2,(H2,40,43,44,45) |
| InChIKey | IKVQZFFQWHMIBO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.21 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|