About 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate
2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate (PubChem CID 176914279) has the molecular formula C24H24ClN3O4
and a molecular weight of 453.93 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate |
| PubChem CID | 176914279 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate |
| SMILES | CCC(C)(C)OC(=O)c1ccc(N2C(=O)N(c3ccc(C#N)cc3)C(=O)C2(C)C)cc1Cl |
| InChI | InChI=1S/C24H24ClN3O4/c1-6-23(2,3)32-20(29)18-12-11-17(13-19(18)25)28-22(31)27(21(30)24(28,4)5)16-9-7-15(14-26)8-10-16/h7-13H,6H2,1-5H3 |
| InChIKey | NKGKLFGCURJYHZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate?
The IUPAC name of 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate (CID 176914279) is 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate.
What is the SMILES notation for 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate?
The canonical SMILES for 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate is CCC(C)(C)OC(=O)c1ccc(N2C(=O)N(c3ccc(C#N)cc3)C(=O)C2(C)C)cc1Cl.
What is the InChIKey of 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate?
The InChIKey is NKGKLFGCURJYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24ClN3O4/c1-6-23(2,3)32-20(29)18-12-11-17(13-19(18)25)28-22(31)27(21(30)24(28,4)5)16-9-7-15(14-26)8-10-16/h7-13H,6H2,1-5H3.
What are the key properties of 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate?
2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate has a molecular weight of 453.93 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 2-chloro-4-[3-(4-cyanophenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]benzoate is sourced from PubChem (CID 176914279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).