C18H23F2N3O4 — CID 176914976
1-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-1,3-diazinane-2,4-dione (PubChem CID 176914976) has the molecular formula C18H23F2N3O4 and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 176914976 |
| Molecular Formula | C18H23F2N3O4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2,6-difluorophenyl]-1,3-diazinane-2,4-dione |
| SMILES | COC(OC)C1CCN(c2cc(F)c(N3CCC(=O)NC3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C18H23F2N3O4/c1-26-17(27-2)11-3-6-22(7-4-11)12-9-13(19)16(14(20)10-12)23-8-5-15(24)21-18(23)25/h9-11,17H,3-8H2,1-2H3,(H,21,24,25) |
| InChIKey | ZPPCGDMRBXHBIK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|