About 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile
3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile (PubChem CID 176915110) has the molecular formula C9H5F3INO
and a molecular weight of 327.04 g/mol. Its IUPAC name is 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile.
Molecular Properties
| Compound Name | 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile |
| PubChem CID | 176915110 |
| Molecular Formula | C9H5F3INO |
| Molecular Weight | 327.04 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile |
| SMILES | N#Cc1cccc(I)c1OCC(F)(F)F |
| InChI | InChI=1S/C9H5F3INO/c10-9(11,12)5-15-8-6(4-14)2-1-3-7(8)13/h1-3H,5H2 |
| InChIKey | RVXICNMTUHJFMC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.04 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile?
The IUPAC name of 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile (CID 176915110) is 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile.
What is the SMILES notation for 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile?
The canonical SMILES for 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile is N#Cc1cccc(I)c1OCC(F)(F)F.
What is the InChIKey of 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile?
The InChIKey is RVXICNMTUHJFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3INO/c10-9(11,12)5-15-8-6(4-14)2-1-3-7(8)13/h1-3H,5H2.
What are the key properties of 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile?
3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile has a molecular weight of 327.04 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-(2,2,2-trifluoroethoxy)benzonitrile is sourced from PubChem (CID 176915110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).