C30H22N2O — CID 176915624
N-(4-nitrosophenyl)-4-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 176915624) has the molecular formula C30H22N2O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(4-nitrosophenyl)-4-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-(4-nitrosophenyl)-4-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 176915624 |
| Molecular Formula | C30H22N2O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(4-nitrosophenyl)-4-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | O=Nc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H22N2O/c33-31-27-15-21-30(22-16-27)32(28-17-11-25(12-18-28)23-7-3-1-4-8-23)29-19-13-26(14-20-29)24-9-5-2-6-10-24/h1-22H |
| InChIKey | NHAJPJGXENHGKU-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |