C19H33ClN2O4SSi — CID 176916288
(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-2,5-dimethylhex-5-en-3-ol (PubChem CID 176916288) has the molecular formula C19H33ClN2O4SSi and a molecular weight of 449.09 g/mol. Its IUPAC name is (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-2,5-dimethylhex-5-en-3-ol.
| Compound Name | (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-2,5-dimethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 176916288 |
| Molecular Formula | C19H33ClN2O4SSi |
| Molecular Weight | 449.09 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-2,5-dimethylhex-5-en-3-ol |
| SMILES | C=C(C)C[C@@H](O)[C@](C)(CO[Si](C)(C)C(C)(C)C)c1cnc(S(C)(=O)=O)nc1Cl |
| InChI | InChI=1S/C19H33ClN2O4SSi/c1-13(2)10-15(23)19(6,12-26-28(8,9)18(3,4)5)14-11-21-17(22-16(14)20)27(7,24)25/h11,15,23H,1,10,12H2,2-9H3/t15-,19-/m1/s1 |
| InChIKey | VCCLFGZSPUZWRH-DNVCBOLYSA-N |
| XLogP | 4.14 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.09 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|