C19H14F4N2O2 — CID 176916401
6-fluoro-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]quinoline-8-carboxamide (PubChem CID 176916401) has the molecular formula C19H14F4N2O2 and a molecular weight of 378.33 g/mol. Its IUPAC name is 6-fluoro-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]quinoline-8-carboxamide.
| Compound Name | 6-fluoro-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 176916401 |
| Molecular Formula | C19H14F4N2O2 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 6-fluoro-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]quinoline-8-carboxamide |
| SMILES | O=C(NC(CO)c1ccc(C(F)(F)F)cc1)c1cc(F)cc2cccnc12 |
| InChI | InChI=1S/C19H14F4N2O2/c20-14-8-12-2-1-7-24-17(12)15(9-14)18(27)25-16(10-26)11-3-5-13(6-4-11)19(21,22)23/h1-9,16,26H,10H2,(H,25,27) |
| InChIKey | LRQSFSFBLDPYFX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |