About 4-but-3-enyl-1,4-oxazepan-5-one
4-but-3-enyl-1,4-oxazepan-5-one (PubChem CID 176916644) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 4-but-3-enyl-1,4-oxazepan-5-one.
Molecular Properties
| Compound Name | 4-but-3-enyl-1,4-oxazepan-5-one |
| PubChem CID | 176916644 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 4-but-3-enyl-1,4-oxazepan-5-one |
| SMILES | C=CCCN1CCOCCC1=O |
| InChI | InChI=1S/C9H15NO2/c1-2-3-5-10-6-8-12-7-4-9(10)11/h2H,1,3-8H2 |
| InChIKey | ZJJRNTKSBVMJPP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enyl-1,4-oxazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enyl-1,4-oxazepan-5-one?
The IUPAC name of 4-but-3-enyl-1,4-oxazepan-5-one (CID 176916644) is 4-but-3-enyl-1,4-oxazepan-5-one.
What is the SMILES notation for 4-but-3-enyl-1,4-oxazepan-5-one?
The canonical SMILES for 4-but-3-enyl-1,4-oxazepan-5-one is C=CCCN1CCOCCC1=O.
What is the InChIKey of 4-but-3-enyl-1,4-oxazepan-5-one?
The InChIKey is ZJJRNTKSBVMJPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-2-3-5-10-6-8-12-7-4-9(10)11/h2H,1,3-8H2.
What are the key properties of 4-but-3-enyl-1,4-oxazepan-5-one?
4-but-3-enyl-1,4-oxazepan-5-one has a molecular weight of 169.22 g/mol, XLogP of 0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enyl-1,4-oxazepan-5-one is sourced from PubChem (CID 176916644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).