About CID 176916980
CID 176916980 (PubChem CID 176916980) has the molecular formula C17H14BN7
and a molecular weight of 327.16 g/mol.
Molecular Properties
| Compound Name | CID 176916980 |
| PubChem CID | 176916980 |
| Molecular Formula | C17H14BN7 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(-c4ccccn4)cc3)nc(N)nc12 |
| InChI | InChI=1S/C17H14BN7/c18-13-10-22-25-15(13)23-16(19)24-17(25)21-9-11-4-6-12(7-5-11)14-3-1-2-8-20-14/h1-8,10H,9H2,(H3,19,21,23,24) |
| InChIKey | AOGOAHRMPVTDQD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176916980 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176916980?
The IUPAC name of CID 176916980 (CID 176916980) is not available.
What is the SMILES notation for CID 176916980?
The canonical SMILES for CID 176916980 is [B]c1cnn2c(NCc3ccc(-c4ccccn4)cc3)nc(N)nc12.
What is the InChIKey of CID 176916980?
The InChIKey is AOGOAHRMPVTDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BN7/c18-13-10-22-25-15(13)23-16(19)24-17(25)21-9-11-4-6-12(7-5-11)14-3-1-2-8-20-14/h1-8,10H,9H2,(H3,19,21,23,24).
What are the key properties of CID 176916980?
CID 176916980 has a molecular weight of 327.16 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176916980 is sourced from PubChem (CID 176916980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).