C26H46O8 — CID 176917595
diethyl (3aS,4R,8S,8aR)-2,6-diheptyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate (PubChem CID 176917595) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is diethyl (3aS,4R,8S,8aR)-2,6-diheptyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate.
| Compound Name | diethyl (3aS,4R,8S,8aR)-2,6-diheptyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate |
|---|---|
| PubChem CID | 176917595 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | diethyl (3aS,4R,8S,8aR)-2,6-diheptyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate |
| SMILES | CCCCCCCC1O[C@@H]2[C@H](O1)[C@H](C(=O)OCC)OC(CCCCCCC)O[C@@H]2C(=O)OCC |
| InChI | InChI=1S/C26H46O8/c1-5-9-11-13-15-17-19-31-21-22(32-19)24(26(28)30-8-4)34-20(18-16-14-12-10-6-2)33-23(21)25(27)29-7-3/h19-24H,5-18H2,1-4H3/t19?,20?,21-,22+,23+,24- |
| InChIKey | AALOGXOOUNUMPV-WCFXHMFSSA-N |
| XLogP | 5.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|