C29H54O8 — CID 176917611
diethyl (3aS,4R,8S,8aR)-2,6-dioctyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate;methane (PubChem CID 176917611) has the molecular formula C29H54O8 and a molecular weight of 530.74 g/mol. Its IUPAC name is diethyl (3aS,4R,8S,8aR)-2,6-dioctyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate;methane.
| Compound Name | diethyl (3aS,4R,8S,8aR)-2,6-dioctyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate;methane |
|---|---|
| PubChem CID | 176917611 |
| Molecular Formula | C29H54O8 |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | diethyl (3aS,4R,8S,8aR)-2,6-dioctyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepine-4,8-dicarboxylate;methane |
| SMILES | C.CCCCCCCCC1O[C@@H]2[C@H](O1)[C@H](C(=O)OCC)OC(CCCCCCCC)O[C@@H]2C(=O)OCC |
| InChI | InChI=1S/C28H50O8.CH4/c1-5-9-11-13-15-17-19-21-33-23-24(34-21)26(28(30)32-8-4)36-22(20-18-16-14-12-10-6-2)35-25(23)27(29)31-7-3;/h21-26H,5-20H2,1-4H3;1H4/t21?,22?,23-,24+,25+,26-; |
| InChIKey | WNZTZQCHRKGVHR-CPZZVHJOSA-N |
| XLogP | 6.47 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|