C18H30N4 — CID 176918774
1-methyl-4-[3-(2-methyl-2-pyridin-3-ylpyrrolidin-1-yl)propyl]piperazine (PubChem CID 176918774) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is 1-methyl-4-[3-(2-methyl-2-pyridin-3-ylpyrrolidin-1-yl)propyl]piperazine.
| Compound Name | 1-methyl-4-[3-(2-methyl-2-pyridin-3-ylpyrrolidin-1-yl)propyl]piperazine |
|---|---|
| PubChem CID | 176918774 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 1-methyl-4-[3-(2-methyl-2-pyridin-3-ylpyrrolidin-1-yl)propyl]piperazine |
| SMILES | CN1CCN(CCCN2CCCC2(C)c2cccnc2)CC1 |
| InChI | InChI=1S/C18H30N4/c1-18(17-6-3-8-19-16-17)7-4-10-22(18)11-5-9-21-14-12-20(2)13-15-21/h3,6,8,16H,4-5,7,9-15H2,1-2H3 |
| InChIKey | QGSPQRBSCAVNGM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |