C22H27N7OS — CID 176919026
8-(1,1-dimethylthian-4-yl)-5-methyl-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 176919026) has the molecular formula C22H27N7OS and a molecular weight of 437.57 g/mol. Its IUPAC name is 8-(1,1-dimethylthian-4-yl)-5-methyl-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(1,1-dimethylthian-4-yl)-5-methyl-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 176919026 |
| Molecular Formula | C22H27N7OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 8-(1,1-dimethylthian-4-yl)-5-methyl-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc2ncnn2cc1Nc1ncc2c(C)cc(=O)n(C3CCS(C)(C)CC3)c2n1 |
| InChI | InChI=1S/C22H27N7OS/c1-14-10-20(30)29(16-5-7-31(3,4)8-6-16)21-17(14)11-23-22(27-21)26-18-12-28-19(9-15(18)2)24-13-25-28/h9-13,16H,5-8H2,1-4H3,(H,23,26,27) |
| InChIKey | DLNPHYUNDCEHPV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |