C21H27N7O2Si- — CID 176919052
CID 176919052 (PubChem CID 176919052) has the molecular formula C21H27N7O2Si- and a molecular weight of 437.58 g/mol.
| Compound Name | CID 176919052 |
|---|---|
| PubChem CID | 176919052 |
| Molecular Formula | C21H27N7O2Si- |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | — |
| SMILES | Cc1cc2nonc2cc1Nc1ncc2c(n1)N(C1CC[Si-](C)(C)CC1)CC(=O)N2C |
| InChI | InChI=1S/C21H27N7O2Si/c1-13-9-16-17(26-30-25-16)10-15(13)23-21-22-11-18-20(24-21)28(12-19(29)27(18)2)14-5-7-31(3,4)8-6-14/h9-11,14H,5-8,12H2,1-4H3,(H,22,23,24)/q-1 |
| InChIKey | RAGNBPALQGXULW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|