C19H27N7OS — CID 176919128
2-[[(1E)-1-[amino(methyl)amino]-3-methylbuta-1,3-dien-2-yl]amino]-9-(4-hydroxy-1-bicyclo[2.2.1]heptanyl)-7-methylpurine-8-thione (PubChem CID 176919128) has the molecular formula C19H27N7OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-[[(1E)-1-[amino(methyl)amino]-3-methylbuta-1,3-dien-2-yl]amino]-9-(4-hydroxy-1-bicyclo[2.2.1]heptanyl)-7-methylpurine-8-thione.
| Compound Name | 2-[[(1E)-1-[amino(methyl)amino]-3-methylbuta-1,3-dien-2-yl]amino]-9-(4-hydroxy-1-bicyclo[2.2.1]heptanyl)-7-methylpurine-8-thione |
|---|---|
| PubChem CID | 176919128 |
| Molecular Formula | C19H27N7OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[[(1E)-1-[amino(methyl)amino]-3-methylbuta-1,3-dien-2-yl]amino]-9-(4-hydroxy-1-bicyclo[2.2.1]heptanyl)-7-methylpurine-8-thione |
| SMILES | C=C(C)/C(=C\N(C)N)Nc1ncc2c(n1)n(C13CCC(O)(CC1)C3)c(=S)n2C |
| InChI | InChI=1S/C19H27N7OS/c1-12(2)13(10-24(3)20)22-16-21-9-14-15(23-16)26(17(28)25(14)4)18-5-7-19(27,11-18)8-6-18/h9-10,27H,1,5-8,11,20H2,2-4H3,(H,21,22,23)/b13-10+ |
| InChIKey | SOSFOOOUFYUBMZ-JLHYYAGUSA-N |
| XLogP | 2.54 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|