About (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane
(2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane (PubChem CID 176919390) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane.
Molecular Properties
| Compound Name | (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane |
| PubChem CID | 176919390 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane |
| SMILES | CCC.CC[C@]1(C)CC(=C(F)F)CN1C |
| InChI | InChI=1S/C9H15F2N.C3H8/c1-4-9(2)5-7(8(10)11)6-12(9)3;1-3-2/h4-6H2,1-3H3;3H2,1-2H3/t9-;/m1./s1 |
| InChIKey | CHADVOKSJMEKSA-SBSPUUFOSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane?
The IUPAC name of (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane (CID 176919390) is (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane.
What is the SMILES notation for (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane?
The canonical SMILES for (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane is CCC.CC[C@]1(C)CC(=C(F)F)CN1C.
What is the InChIKey of (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane?
The InChIKey is CHADVOKSJMEKSA-SBSPUUFOSA-N. The full InChI is InChI=1S/C9H15F2N.C3H8/c1-4-9(2)5-7(8(10)11)6-12(9)3;1-3-2/h4-6H2,1-3H3;3H2,1-2H3/t9-;/m1./s1.
What are the key properties of (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane?
(2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane has a molecular weight of 219.32 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(difluoromethylidene)-2-ethyl-1,2-dimethylpyrrolidine;propane is sourced from PubChem (CID 176919390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).