About (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine
(4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine (PubChem CID 176919452) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine.
Molecular Properties
| Compound Name | (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine |
| PubChem CID | 176919452 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine |
| SMILES | CN1C/C(=C\F)CC1(C)C |
| InChI | InChI=1S/C8H14FN/c1-8(2)4-7(5-9)6-10(8)3/h5H,4,6H2,1-3H3/b7-5- |
| InChIKey | GXQQHSYOWZGWGU-ALCCZGGFSA-N |
| XLogP | 1.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine?
The IUPAC name of (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine (CID 176919452) is (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine.
What is the SMILES notation for (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine?
The canonical SMILES for (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine is CN1C/C(=C\F)CC1(C)C.
What is the InChIKey of (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine?
The InChIKey is GXQQHSYOWZGWGU-ALCCZGGFSA-N. The full InChI is InChI=1S/C8H14FN/c1-8(2)4-7(5-9)6-10(8)3/h5H,4,6H2,1-3H3/b7-5-.
What are the key properties of (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine?
(4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine has a molecular weight of 143.20 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(fluoromethylidene)-1,2,2-trimethylpyrrolidine is sourced from PubChem (CID 176919452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).