C30H32F2N6OS — CID 176919530
2-amino-5-[(1E,3E)-4-[4-amino-6-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-prop-1-en-2-ylquinazolin-7-yl]-1-fluorobuta-1,3-dienyl]thiophene-3-carbonitrile (PubChem CID 176919530) has the molecular formula C30H32F2N6OS and a molecular weight of 562.69 g/mol. Its IUPAC name is 2-amino-5-[(1E,3E)-4-[4-amino-6-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-prop-1-en-2-ylquinazolin-7-yl]-1-fluorobuta-1,3-dienyl]thiophene-3-carbonitrile.
| Compound Name | 2-amino-5-[(1E,3E)-4-[4-amino-6-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-prop-1-en-2-ylquinazolin-7-yl]-1-fluorobuta-1,3-dienyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 176919530 |
| Molecular Formula | C30H32F2N6OS |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-amino-5-[(1E,3E)-4-[4-amino-6-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-prop-1-en-2-ylquinazolin-7-yl]-1-fluorobuta-1,3-dienyl]thiophene-3-carbonitrile |
| SMILES | C=C(C)c1c(CC)c(/C=C/C=C(/F)c2cc(C#N)c(N)s2)c(F)c2nc(OCC34CCCN3CCC4)nc(N)c12 |
| InChI | InChI=1S/C30H32F2N6OS/c1-4-19-20(8-5-9-21(31)22-14-18(15-33)28(35)40-22)25(32)26-24(23(19)17(2)3)27(34)37-29(36-26)39-16-30-10-6-12-38(30)13-7-11-30/h5,8-9,14H,2,4,6-7,10-13,16,35H2,1,3H3,(H2,34,36,37)/b8-5+,21-9+ |
| InChIKey | GJWLVHPJYXCDLH-HWVLTCDVSA-N |
| XLogP | 6.49 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|