About 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate
2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate (PubChem CID 176920020) has the molecular formula C11H11IN2O2S
and a molecular weight of 362.19 g/mol. Its IUPAC name is 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate.
Molecular Properties
| Compound Name | 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate |
| PubChem CID | 176920020 |
| Molecular Formula | C11H11IN2O2S |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate |
| SMILES | Cc1cc(C#N)cc(C(=O)OCCSI)c1N |
| InChI | InChI=1S/C11H11IN2O2S/c1-7-4-8(6-13)5-9(10(7)14)11(15)16-2-3-17-12/h4-5H,2-3,14H2,1H3 |
| InChIKey | NMUQQEVHGPLKKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate?
The IUPAC name of 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate (CID 176920020) is 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate.
What is the SMILES notation for 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate?
The canonical SMILES for 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate is Cc1cc(C#N)cc(C(=O)OCCSI)c1N.
What is the InChIKey of 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate?
The InChIKey is NMUQQEVHGPLKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11IN2O2S/c1-7-4-8(6-13)5-9(10(7)14)11(15)16-2-3-17-12/h4-5H,2-3,14H2,1H3.
What are the key properties of 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate?
2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate has a molecular weight of 362.19 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodosulfanylethyl 2-amino-5-cyano-3-methylbenzoate is sourced from PubChem (CID 176920020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).