C33H32N4O5S — CID 176920489
3-[9-[[4-(aminomethyl)-2,6-dimethylphenyl]carbamoyl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-yl]-6-(but-3-enylcarbamoyl)pyridine-2-carboxylic acid (PubChem CID 176920489) has the molecular formula C33H32N4O5S and a molecular weight of 596.71 g/mol. Its IUPAC name is 3-[9-[[4-(aminomethyl)-2,6-dimethylphenyl]carbamoyl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-yl]-6-(but-3-enylcarbamoyl)pyridine-2-carboxylic acid.
| Compound Name | 3-[9-[[4-(aminomethyl)-2,6-dimethylphenyl]carbamoyl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-yl]-6-(but-3-enylcarbamoyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 176920489 |
| Molecular Formula | C33H32N4O5S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 3-[9-[[4-(aminomethyl)-2,6-dimethylphenyl]carbamoyl]-4,5-dihydrothieno[3,2-d][1]benzoxepin-8-yl]-6-(but-3-enylcarbamoyl)pyridine-2-carboxylic acid |
| SMILES | C=CCCNC(=O)c1ccc(-c2cc3c(cc2C(=O)Nc2c(C)cc(CN)cc2C)-c2sccc2CCO3)c(C(=O)O)n1 |
| InChI | InChI=1S/C33H32N4O5S/c1-4-5-10-35-32(39)26-7-6-22(29(36-26)33(40)41)23-16-27-25(30-21(8-11-42-27)9-12-43-30)15-24(23)31(38)37-28-18(2)13-20(17-34)14-19(28)3/h4,6-7,9,12-16H,1,5,8,10-11,17,34H2,2-3H3,(H,35,39)(H,37,38)(H,40,41) |
| InChIKey | NDRJZSFRRYLIRF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|