C12H19N3OS — CID 176920739
(R)-[(1R,2E,3R)-2-hydrazinylidene-1,3-dimethylcyclohexyl]-(1,3-thiazol-4-yl)methanol (PubChem CID 176920739) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is (R)-[(1R,2E,3R)-2-hydrazinylidene-1,3-dimethylcyclohexyl]-(1,3-thiazol-4-yl)methanol.
| Compound Name | (R)-[(1R,2E,3R)-2-hydrazinylidene-1,3-dimethylcyclohexyl]-(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 176920739 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (R)-[(1R,2E,3R)-2-hydrazinylidene-1,3-dimethylcyclohexyl]-(1,3-thiazol-4-yl)methanol |
| SMILES | C[C@@H]1CCC[C@@](C)([C@@H](O)c2cscn2)/C1=N/N |
| InChI | InChI=1S/C12H19N3OS/c1-8-4-3-5-12(2,10(8)15-13)11(16)9-6-17-7-14-9/h6-8,11,16H,3-5,13H2,1-2H3/b15-10+/t8-,11+,12-/m1/s1 |
| InChIKey | TVOXZWVVKMJKPK-DWMODZQKSA-N |
| XLogP | 2.32 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|