C17H22F3N — CID 176921198
N-methyl-N-[(2Z,4Z)-4-methylhepta-2,4-dien-2-yl]-4-(2,2,2-trifluoroethyl)aniline (PubChem CID 176921198) has the molecular formula C17H22F3N and a molecular weight of 297.36 g/mol. Its IUPAC name is N-methyl-N-[(2Z,4Z)-4-methylhepta-2,4-dien-2-yl]-4-(2,2,2-trifluoroethyl)aniline.
| Compound Name | N-methyl-N-[(2Z,4Z)-4-methylhepta-2,4-dien-2-yl]-4-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 176921198 |
| Molecular Formula | C17H22F3N |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-methyl-N-[(2Z,4Z)-4-methylhepta-2,4-dien-2-yl]-4-(2,2,2-trifluoroethyl)aniline |
| SMILES | CC/C=C(C)\C=C(\C)N(C)c1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3N/c1-5-6-13(2)11-14(3)21(4)16-9-7-15(8-10-16)12-17(18,19)20/h6-11H,5,12H2,1-4H3/b13-6-,14-11- |
| InChIKey | VHFSJQUSWNCXNF-LOVXHATNSA-N |
| XLogP | 5.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|