C17H26F3NO — CID 176921294
(Z)-4-methylhept-3-en-2-imine;(3Z,5E)-3-methyl-6-(trifluoromethoxy)hepta-1,3,5-triene (PubChem CID 176921294) has the molecular formula C17H26F3NO and a molecular weight of 317.40 g/mol. Its IUPAC name is (Z)-4-methylhept-3-en-2-imine;(3Z,5E)-3-methyl-6-(trifluoromethoxy)hepta-1,3,5-triene.
| Compound Name | (Z)-4-methylhept-3-en-2-imine;(3Z,5E)-3-methyl-6-(trifluoromethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 176921294 |
| Molecular Formula | C17H26F3NO |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (Z)-4-methylhept-3-en-2-imine;(3Z,5E)-3-methyl-6-(trifluoromethoxy)hepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C(/C)OC(F)(F)F.[H]/N=C(C)/C=C(/C)CCC |
| InChI | InChI=1S/C9H11F3O.C8H15N/c1-4-7(2)5-6-8(3)13-9(10,11)12;1-4-5-7(2)6-8(3)9/h4-6H,1H2,2-3H3;6,9H,4-5H2,1-3H3/b7-5-,8-6+;7-6-,9-8+ |
| InChIKey | FITSDHAJDDANDF-PIGGZZSISA-N |
| XLogP | 6.33 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|