About butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane
butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane (PubChem CID 176921476) has the molecular formula C20H34BF3O2
and a molecular weight of 374.30 g/mol. Its IUPAC name is butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane.
Molecular Properties
| Compound Name | butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane |
| PubChem CID | 176921476 |
| Molecular Formula | C20H34BF3O2 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane |
| SMILES | CB(OC(C)(C)C(C)(C)C)c1ccc(C)c(OC(F)(F)F)c1.CCCC |
| InChI | InChI=1S/C16H24BF3O2.C4H10/c1-11-8-9-12(10-13(11)21-16(18,19)20)17(7)22-15(5,6)14(2,3)4;1-3-4-2/h8-10H,1-7H3;3-4H2,1-2H3 |
| InChIKey | LDOCXEQSMPTSMW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane?
The IUPAC name of butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane (CID 176921476) is butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane.
What is the SMILES notation for butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane?
The canonical SMILES for butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane is CB(OC(C)(C)C(C)(C)C)c1ccc(C)c(OC(F)(F)F)c1.CCCC.
What is the InChIKey of butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane?
The InChIKey is LDOCXEQSMPTSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BF3O2.C4H10/c1-11-8-9-12(10-13(11)21-16(18,19)20)17(7)22-15(5,6)14(2,3)4;1-3-4-2/h8-10H,1-7H3;3-4H2,1-2H3.
What are the key properties of butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane?
butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane has a molecular weight of 374.30 g/mol, XLogP of 6.37, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;methyl-[4-methyl-3-(trifluoromethoxy)phenyl]-(2,3,3-trimethylbutan-2-yloxy)borane is sourced from PubChem (CID 176921476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).