About tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate
tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate (PubChem CID 176921501) has the molecular formula C22H35F2N3O2
and a molecular weight of 411.54 g/mol. Its IUPAC name is tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate |
| PubChem CID | 176921501 |
| Molecular Formula | C22H35F2N3O2 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate |
| SMILES | Cc1cc(CC2CCCN(C(=O)OC(C)(C)C)CC2)nn1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C22H35F2N3O2/c1-16-14-18(25-27(16)19-7-10-22(23,24)11-8-19)15-17-6-5-12-26(13-9-17)20(28)29-21(2,3)4/h14,17,19H,5-13,15H2,1-4H3 |
| InChIKey | SGVMJNSANQUWKL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate?
The IUPAC name of tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate (CID 176921501) is tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate is Cc1cc(CC2CCCN(C(=O)OC(C)(C)C)CC2)nn1C1CCC(F)(F)CC1.
What is the InChIKey of tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate?
The InChIKey is SGVMJNSANQUWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35F2N3O2/c1-16-14-18(25-27(16)19-7-10-22(23,24)11-8-19)15-17-6-5-12-26(13-9-17)20(28)29-21(2,3)4/h14,17,19H,5-13,15H2,1-4H3.
What are the key properties of tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate?
tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate has a molecular weight of 411.54 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[1-(4,4-difluorocyclohexyl)-5-methylpyrazol-3-yl]methyl]azepane-1-carboxylate is sourced from PubChem (CID 176921501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).