About 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine
1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine (PubChem CID 176921517) has the molecular formula C23H35F2N3
and a molecular weight of 391.55 g/mol. Its IUPAC name is 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine.
Molecular Properties
| Compound Name | 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine |
| PubChem CID | 176921517 |
| Molecular Formula | C23H35F2N3 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine |
| SMILES | CCCN(CCC(C)CC)c1cc(C(C)C)n(-c2ccc(C(C)(F)F)cc2)n1 |
| InChI | InChI=1S/C23H35F2N3/c1-7-14-27(15-13-18(5)8-2)22-16-21(17(3)4)28(26-22)20-11-9-19(10-12-20)23(6,24)25/h9-12,16-18H,7-8,13-15H2,1-6H3 |
| InChIKey | AQXYYOPDXADSLX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine?
The IUPAC name of 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine (CID 176921517) is 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine.
What is the SMILES notation for 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine?
The canonical SMILES for 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine is CCCN(CCC(C)CC)c1cc(C(C)C)n(-c2ccc(C(C)(F)F)cc2)n1.
What is the InChIKey of 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine?
The InChIKey is AQXYYOPDXADSLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35F2N3/c1-7-14-27(15-13-18(5)8-2)22-16-21(17(3)4)28(26-22)20-11-9-19(10-12-20)23(6,24)25/h9-12,16-18H,7-8,13-15H2,1-6H3.
What are the key properties of 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine?
1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine has a molecular weight of 391.55 g/mol, XLogP of 6.76, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,1-difluoroethyl)phenyl]-N-(3-methylpentyl)-5-propan-2-yl-N-propylpyrazol-3-amine is sourced from PubChem (CID 176921517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).