About (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine
(E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine (PubChem CID 176921652) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine |
| PubChem CID | 176921652 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine |
| SMILES | [H]/N=C/C(=C(/C)CCC)N1CC2(CNC2)C1 |
| InChI | InChI=1S/C12H21N3/c1-3-4-10(2)11(5-13)15-8-12(9-15)6-14-7-12/h5,13-14H,3-4,6-9H2,1-2H3/b11-10+,13-5+ |
| InChIKey | AHNCBFNISRLREH-YNAFNXDGSA-N |
| XLogP | 1.62 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine?
The IUPAC name of (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine (CID 176921652) is (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine.
What is the SMILES notation for (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine?
The canonical SMILES for (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine is [H]/N=C/C(=C(/C)CCC)N1CC2(CNC2)C1.
What is the InChIKey of (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine?
The InChIKey is AHNCBFNISRLREH-YNAFNXDGSA-N. The full InChI is InChI=1S/C12H21N3/c1-3-4-10(2)11(5-13)15-8-12(9-15)6-14-7-12/h5,13-14H,3-4,6-9H2,1-2H3/b11-10+,13-5+.
What are the key properties of (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine?
(E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine has a molecular weight of 207.32 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(2,6-diazaspiro[3.3]heptan-2-yl)-3-methylhex-2-en-1-imine is sourced from PubChem (CID 176921652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).